C25H21FN2O4S — CID 22784121
methyl 2-[4-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate (PubChem CID 22784121) has the molecular formula C25H21FN2O4S and a molecular weight of 464.52 g/mol. Its IUPAC name is methyl 2-[4-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate.
| Compound Name | methyl 2-[4-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 22784121 |
| Molecular Formula | C25H21FN2O4S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | methyl 2-[4-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate |
| SMILES | COC(=O)CSc1ccc(NC(=O)/C(=C/c2ccccc2F)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21FN2O4S/c1-32-23(29)16-33-20-13-11-19(12-14-20)27-25(31)22(15-18-9-5-6-10-21(18)26)28-24(30)17-7-3-2-4-8-17/h2-15H,16H2,1H3,(H,27,31)(H,28,30)/b22-15- |
| InChIKey | ZKEUOCAEXVOZFN-JCMHNJIXSA-N |
| XLogP | 4.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|