C22H16FIN2O2 — CID 1108518
N-[1-(2-fluorophenyl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 1108518) has the molecular formula C22H16FIN2O2 and a molecular weight of 486.28 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(2-fluorophenyl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 1108518 |
| Molecular Formula | C22H16FIN2O2 |
| Molecular Weight | 486.28 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | N-[1-(2-fluorophenyl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(I)cc1)C(=Cc1ccccc1F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H16FIN2O2/c23-19-9-5-4-8-16(19)14-20(26-21(27)15-6-2-1-3-7-15)22(28)25-18-12-10-17(24)11-13-18/h1-14H,(H,25,28)(H,26,27) |
| InChIKey | FMTYTDYDCKBIDA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|