C16H11FNO3- — CID 2063688
(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 2063688) has the molecular formula C16H11FNO3- and a molecular weight of 284.27 g/mol. Its IUPAC name is (Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | (Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2063688 |
| Molecular Formula | C16H11FNO3- |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | O=C([O-])/C(=C/c1ccccc1F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H12FNO3/c17-13-9-5-4-8-12(13)10-14(16(20)21)18-15(19)11-6-2-1-3-7-11/h1-10H,(H,18,19)(H,20,21)/p-1/b14-10- |
| InChIKey | VEWYDJBKJCXPSI-UVTDQMKNSA-M |
| XLogP | 1.35 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|