C25H21FN2O4 — CID 5341890
benzyl 2-[[(E)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]acetate (PubChem CID 5341890) has the molecular formula C25H21FN2O4 and a molecular weight of 432.45 g/mol. Its IUPAC name is benzyl 2-[[(E)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]acetate.
| Compound Name | benzyl 2-[[(E)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 5341890 |
| Molecular Formula | C25H21FN2O4 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | benzyl 2-[[(E)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]acetate |
| SMILES | O=C(CNC(=O)/C(=C\c1ccccc1F)NC(=O)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H21FN2O4/c26-21-14-8-7-13-20(21)15-22(28-24(30)19-11-5-2-6-12-19)25(31)27-16-23(29)32-17-18-9-3-1-4-10-18/h1-15H,16-17H2,(H,27,31)(H,28,30)/b22-15+ |
| InChIKey | CKKALLGVONEDHA-PXLXIMEGSA-N |
| XLogP | 3.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|