C22H23FN2O5 — CID 7353398
ethyl (2S,3S)-2-[[(E)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]-3-hydroxybutanoate (PubChem CID 7353398) has the molecular formula C22H23FN2O5 and a molecular weight of 414.43 g/mol. Its IUPAC name is ethyl (2S,3S)-2-[[(E)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]-3-hydroxybutanoate.
| Compound Name | ethyl (2S,3S)-2-[[(E)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 7353398 |
| Molecular Formula | C22H23FN2O5 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | ethyl (2S,3S)-2-[[(E)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]-3-hydroxybutanoate |
| SMILES | CCOC(=O)[C@@H](NC(=O)/C(=C\c1ccccc1F)NC(=O)c1ccccc1)[C@H](C)O |
| InChI | InChI=1S/C22H23FN2O5/c1-3-30-22(29)19(14(2)26)25-21(28)18(13-16-11-7-8-12-17(16)23)24-20(27)15-9-5-4-6-10-15/h4-14,19,26H,3H2,1-2H3,(H,24,27)(H,25,28)/b18-13+/t14-,19-/m0/s1 |
| InChIKey | RKCCPANIHQFLIY-KZXBMHGKSA-N |
| XLogP | 2.03 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|