C26H19FN2O2 — CID 6516961
N-[(Z)-1-(2-fluorophenyl)-3-(naphthalen-1-ylamino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 6516961) has the molecular formula C26H19FN2O2 and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[(Z)-1-(2-fluorophenyl)-3-(naphthalen-1-ylamino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-fluorophenyl)-3-(naphthalen-1-ylamino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6516961 |
| Molecular Formula | C26H19FN2O2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[(Z)-1-(2-fluorophenyl)-3-(naphthalen-1-ylamino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc2ccccc12)/C(=C/c1ccccc1F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H19FN2O2/c27-22-15-7-5-12-20(22)17-24(29-25(30)19-10-2-1-3-11-19)26(31)28-23-16-8-13-18-9-4-6-14-21(18)23/h1-17H,(H,28,31)(H,29,30)/b24-17- |
| InChIKey | BREWQAPPCQTERG-ULJHMMPZSA-N |
| XLogP | 5.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|