C16H10F2NO3- — CID 2279163
(Z)-2-[(4-fluorobenzoyl)amino]-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 2279163) has the molecular formula C16H10F2NO3- and a molecular weight of 302.26 g/mol. Its IUPAC name is (Z)-2-[(4-fluorobenzoyl)amino]-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | (Z)-2-[(4-fluorobenzoyl)amino]-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2279163 |
| Molecular Formula | C16H10F2NO3- |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (Z)-2-[(4-fluorobenzoyl)amino]-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C([O-])/C(=C/c1ccc(F)cc1)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H11F2NO3/c17-12-5-1-10(2-6-12)9-14(16(21)22)19-15(20)11-3-7-13(18)8-4-11/h1-9H,(H,19,20)(H,21,22)/p-1/b14-9- |
| InChIKey | IEQPMMZJIGVJTE-ZROIWOOFSA-M |
| XLogP | 1.49 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|