C17H13ClNO3- — CID 2059163
(E)-3-(4-chlorophenyl)-2-[(4-methylbenzoyl)amino]prop-2-enoate (PubChem CID 2059163) has the molecular formula C17H13ClNO3- and a molecular weight of 314.75 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-[(4-methylbenzoyl)amino]prop-2-enoate.
| Compound Name | (E)-3-(4-chlorophenyl)-2-[(4-methylbenzoyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 2059163 |
| Molecular Formula | C17H13ClNO3- |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-[(4-methylbenzoyl)amino]prop-2-enoate |
| SMILES | Cc1ccc(C(=O)N/C(=C/c2ccc(Cl)cc2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H14ClNO3/c1-11-2-6-13(7-3-11)16(20)19-15(17(21)22)10-12-4-8-14(18)9-5-12/h2-10H,1H3,(H,19,20)(H,21,22)/p-1/b15-10+ |
| InChIKey | LDMSUNMGOMPXHB-XNTDXEJSSA-M |
| XLogP | 2.17 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|