C20H19ClNO5- — CID 7481722
(E)-2-[(4-chlorobenzoyl)amino]-3-(3,4-diethoxyphenyl)prop-2-enoate (PubChem CID 7481722) has the molecular formula C20H19ClNO5- and a molecular weight of 388.83 g/mol. Its IUPAC name is (E)-2-[(4-chlorobenzoyl)amino]-3-(3,4-diethoxyphenyl)prop-2-enoate.
| Compound Name | (E)-2-[(4-chlorobenzoyl)amino]-3-(3,4-diethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7481722 |
| Molecular Formula | C20H19ClNO5- |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (E)-2-[(4-chlorobenzoyl)amino]-3-(3,4-diethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C(/NC(=O)c2ccc(Cl)cc2)C(=O)[O-])cc1OCC |
| InChI | InChI=1S/C20H20ClNO5/c1-3-26-17-10-5-13(12-18(17)27-4-2)11-16(20(24)25)22-19(23)14-6-8-15(21)9-7-14/h5-12H,3-4H2,1-2H3,(H,22,23)(H,24,25)/p-1/b16-11+ |
| InChIKey | WDKIIIGXBOOQCB-LFIBNONCSA-M |
| XLogP | 2.66 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|