C21H22NO5- — CID 7481356
(E)-3-(3,4-diethoxyphenyl)-2-[(2-methylbenzoyl)amino]prop-2-enoate (PubChem CID 7481356) has the molecular formula C21H22NO5- and a molecular weight of 368.41 g/mol. Its IUPAC name is (E)-3-(3,4-diethoxyphenyl)-2-[(2-methylbenzoyl)amino]prop-2-enoate.
| Compound Name | (E)-3-(3,4-diethoxyphenyl)-2-[(2-methylbenzoyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 7481356 |
| Molecular Formula | C21H22NO5- |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (E)-3-(3,4-diethoxyphenyl)-2-[(2-methylbenzoyl)amino]prop-2-enoate |
| SMILES | CCOc1ccc(/C=C(/NC(=O)c2ccccc2C)C(=O)[O-])cc1OCC |
| InChI | InChI=1S/C21H23NO5/c1-4-26-18-11-10-15(13-19(18)27-5-2)12-17(21(24)25)22-20(23)16-9-7-6-8-14(16)3/h6-13H,4-5H2,1-3H3,(H,22,23)(H,24,25)/p-1/b17-12+ |
| InChIKey | GQYSHFJQFCELLN-SFQUDFHCSA-M |
| XLogP | 2.31 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|