C24H21N2O5- — CID 7561503
4-[(2Z)-2-[[3-ethoxy-4-(2-methylbenzoyl)oxyphenyl]methylidene]hydrazinyl]benzoate (PubChem CID 7561503) has the molecular formula C24H21N2O5- and a molecular weight of 417.44 g/mol. Its IUPAC name is 4-[(2Z)-2-[[3-ethoxy-4-(2-methylbenzoyl)oxyphenyl]methylidene]hydrazinyl]benzoate.
| Compound Name | 4-[(2Z)-2-[[3-ethoxy-4-(2-methylbenzoyl)oxyphenyl]methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7561503 |
| Molecular Formula | C24H21N2O5- |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-[(2Z)-2-[[3-ethoxy-4-(2-methylbenzoyl)oxyphenyl]methylidene]hydrazinyl]benzoate |
| SMILES | CCOc1cc(/C=N\Nc2ccc(C(=O)[O-])cc2)ccc1OC(=O)c1ccccc1C |
| InChI | InChI=1S/C24H22N2O5/c1-3-30-22-14-17(15-25-26-19-11-9-18(10-12-19)23(27)28)8-13-21(22)31-24(29)20-7-5-4-6-16(20)2/h4-15,26H,3H2,1-2H3,(H,27,28)/p-1/b25-15- |
| InChIKey | FQNNAFOMUPWSSO-MYYYXRDXSA-M |
| XLogP | 3.42 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|