C30H28N2O5 — CID 41145133
[4-[(Z)-[[2-(2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] naphthalene-1-carboxylate (PubChem CID 41145133) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is [4-[(Z)-[[2-(2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[(Z)-[[2-(2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 41145133 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [4-[(Z)-[[2-(2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] naphthalene-1-carboxylate |
| SMILES | CCOc1cc(/C=N\NC(=O)COc2c(C)cccc2C)ccc1OC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H28N2O5/c1-4-35-27-17-22(18-31-32-28(33)19-36-29-20(2)9-7-10-21(29)3)15-16-26(27)37-30(34)25-14-8-12-23-11-5-6-13-24(23)25/h5-18H,4,19H2,1-3H3,(H,32,33)/b31-18- |
| InChIKey | HYWLDKVIRMYJTE-MNBJERMJSA-N |
| XLogP | 5.60 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|