C28H23BrN2O5 — CID 51060241
[4-[(E)-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate (PubChem CID 51060241) has the molecular formula C28H23BrN2O5 and a molecular weight of 547.41 g/mol. Its IUPAC name is [4-[(E)-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate.
| Compound Name | [4-[(E)-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 51060241 |
| Molecular Formula | C28H23BrN2O5 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | [4-[(E)-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate |
| SMILES | CCOc1cc(/C=N/NC(=O)COc2ccc3ccccc3c2Br)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23BrN2O5/c1-2-34-25-16-19(12-14-23(25)36-28(33)21-9-4-3-5-10-21)17-30-31-26(32)18-35-24-15-13-20-8-6-7-11-22(20)27(24)29/h3-17H,2,18H2,1H3,(H,31,32)/b30-17+ |
| InChIKey | JHMDIWKMIHILCW-OCSSWDANSA-N |
| XLogP | 5.75 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|