C24H20BrN3O7 — CID 3098155
[4-[[[2-(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate (PubChem CID 3098155) has the molecular formula C24H20BrN3O7 and a molecular weight of 542.34 g/mol. Its IUPAC name is [4-[[[2-(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate.
| Compound Name | [4-[[[2-(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 3098155 |
| Molecular Formula | C24H20BrN3O7 |
| Molecular Weight | 542.34 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | [4-[[[2-(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate |
| SMILES | CCOc1cc(C=NNC(=O)COc2ccc([N+](=O)[O-])cc2Br)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H20BrN3O7/c1-2-33-22-12-16(8-10-21(22)35-24(30)17-6-4-3-5-7-17)14-26-27-23(29)15-34-20-11-9-18(28(31)32)13-19(20)25/h3-14H,2,15H2,1H3,(H,27,29) |
| InChIKey | LZUFJOTVYONQMB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|