C23H17Br2N3O7 — CID 6062422
[2-bromo-4-[(Z)-[[2-(4-bromo-2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 6062422) has the molecular formula C23H17Br2N3O7 and a molecular weight of 607.21 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-[[2-(4-bromo-2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2-bromo-4-[(Z)-[[2-(4-bromo-2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 6062422 |
| Molecular Formula | C23H17Br2N3O7 |
| Molecular Weight | 607.21 g/mol |
| Exact Mass | 604.94 |
| IUPAC Name | [2-bromo-4-[(Z)-[[2-(4-bromo-2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | COc1cc(Br)ccc1OCC(=O)N/N=C\c1ccc(OC(=O)c2ccc([N+](=O)[O-])cc2)c(Br)c1 |
| InChI | InChI=1S/C23H17Br2N3O7/c1-33-21-11-16(24)5-9-20(21)34-13-22(29)27-26-12-14-2-8-19(18(25)10-14)35-23(30)15-3-6-17(7-4-15)28(31)32/h2-12H,13H2,1H3,(H,27,29)/b26-12- |
| InChIKey | RKFGXXJDYIFILQ-ZRGSRPPYSA-N |
| XLogP | 4.88 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.21 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|