C30H21Br3N2O7 — CID 6054486
[2-(4-bromobenzoyl)oxy-4-[(Z)-[[2-(2-bromo-4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 6054486) has the molecular formula C30H21Br3N2O7 and a molecular weight of 761.22 g/mol. Its IUPAC name is [2-(4-bromobenzoyl)oxy-4-[(Z)-[[2-(2-bromo-4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [2-(4-bromobenzoyl)oxy-4-[(Z)-[[2-(2-bromo-4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 6054486 |
| Molecular Formula | C30H21Br3N2O7 |
| Molecular Weight | 761.22 g/mol |
| Exact Mass | 757.89 |
| IUPAC Name | [2-(4-bromobenzoyl)oxy-4-[(Z)-[[2-(2-bromo-4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | COc1ccc(OCC(=O)N/N=C\c2ccc(OC(=O)c3ccc(Br)cc3)c(OC(=O)c3ccc(Br)cc3)c2)c(Br)c1 |
| InChI | InChI=1S/C30H21Br3N2O7/c1-39-23-11-13-25(24(33)15-23)40-17-28(36)35-34-16-18-2-12-26(41-29(37)19-3-7-21(31)8-4-19)27(14-18)42-30(38)20-5-9-22(32)10-6-20/h2-16H,17H2,1H3,(H,35,36)/b34-16- |
| InChIKey | NYHFHFZAGBJHBD-MJXLXAJKSA-N |
| XLogP | 6.95 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.22 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|