C36H32Br2N4O8 — CID 4631337
[4-[[[6-[2-[[4-(4-bromobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-6-oxohexanoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-bromobenzoate (PubChem CID 4631337) has the molecular formula C36H32Br2N4O8 and a molecular weight of 808.48 g/mol. Its IUPAC name is [4-[[[6-[2-[[4-(4-bromobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-6-oxohexanoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-bromobenzoate.
| Compound Name | [4-[[[6-[2-[[4-(4-bromobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-6-oxohexanoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 4631337 |
| Molecular Formula | C36H32Br2N4O8 |
| Molecular Weight | 808.48 g/mol |
| Exact Mass | 806.06 |
| IUPAC Name | [4-[[[6-[2-[[4-(4-bromobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-6-oxohexanoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-bromobenzoate |
| SMILES | COc1cc(C=NNC(=O)CCCCC(=O)NN=Cc2ccc(OC(=O)c3ccc(Br)cc3)c(OC)c2)ccc1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C36H32Br2N4O8/c1-47-31-19-23(7-17-29(31)49-35(45)25-9-13-27(37)14-10-25)21-39-41-33(43)5-3-4-6-34(44)42-40-22-24-8-18-30(32(20-24)48-2)50-36(46)26-11-15-28(38)16-12-26/h7-22H,3-6H2,1-2H3,(H,41,43)(H,42,44) |
| InChIKey | POEWHTHQGQQTOX-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.48 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|