C24H19BrN6O4 — CID 171985576
[2-methoxy-4-[(E)-[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 171985576) has the molecular formula C24H19BrN6O4 and a molecular weight of 535.36 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [2-methoxy-4-[(E)-[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 171985576 |
| Molecular Formula | C24H19BrN6O4 |
| Molecular Weight | 535.36 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | [2-methoxy-4-[(E)-[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | COc1cc(/C=N/NC(=O)Cn2nnc(-c3ccccc3)n2)ccc1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H19BrN6O4/c1-34-21-13-16(7-12-20(21)35-24(33)18-8-10-19(25)11-9-18)14-26-27-22(32)15-31-29-23(28-30-31)17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,27,32)/b26-14+ |
| InChIKey | AEHNXMMBLLMGOB-VULFUBBASA-N |
| XLogP | 3.48 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|