C25H21N7O6 — CID 6148189
[2-ethoxy-4-[(Z)-[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 6148189) has the molecular formula C25H21N7O6 and a molecular weight of 515.49 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2-ethoxy-4-[(Z)-[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 6148189 |
| Molecular Formula | C25H21N7O6 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | [2-ethoxy-4-[(Z)-[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | CCOc1cc(/C=N\NC(=O)Cn2nnc(-c3ccccc3)n2)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H21N7O6/c1-2-37-22-14-17(8-13-21(22)38-25(34)19-9-11-20(12-10-19)32(35)36)15-26-27-23(33)16-31-29-24(28-30-31)18-6-4-3-5-7-18/h3-15H,2,16H2,1H3,(H,27,33)/b26-15- |
| InChIKey | VTJXECHGRCXGCW-YSMPRRRNSA-N |
| XLogP | 3.02 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|