C22H18N6O5 — CID 4599529
[2-methoxy-4-[[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 4599529) has the molecular formula C22H18N6O5 and a molecular weight of 446.42 g/mol. Its IUPAC name is [2-methoxy-4-[[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-methoxy-4-[[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 4599529 |
| Molecular Formula | C22H18N6O5 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | [2-methoxy-4-[[[2-(5-phenyltetrazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=NNC(=O)Cn2nnc(-c3ccccc3)n2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C22H18N6O5/c1-31-19-12-15(9-10-17(19)33-22(30)18-8-5-11-32-18)13-23-24-20(29)14-28-26-21(25-27-28)16-6-3-2-4-7-16/h2-13H,14H2,1H3,(H,24,29) |
| InChIKey | CXKAKIJADFUVHX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|