C12H15N7O3 — CID 948256
2-(5-aminotetrazol-2-yl)-N-[(3,4-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 948256) has the molecular formula C12H15N7O3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-(5-aminotetrazol-2-yl)-N-[(3,4-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(5-aminotetrazol-2-yl)-N-[(3,4-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 948256 |
| Molecular Formula | C12H15N7O3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(5-aminotetrazol-2-yl)-N-[(3,4-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(C=NNC(=O)Cn2nnc(N)n2)cc1OC |
| InChI | InChI=1S/C12H15N7O3/c1-21-9-4-3-8(5-10(9)22-2)6-14-15-11(20)7-19-17-12(13)16-18-19/h3-6H,7H2,1-2H3,(H2,13,17)(H,15,20) |
| InChIKey | SXCKPUQLRCYBGW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 129.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|