C11H13N7O2 — CID 5424503
2-(5-aminotetrazol-2-yl)-N-[(Z)-(2-methoxyphenyl)methylideneamino]acetamide (PubChem CID 5424503) has the molecular formula C11H13N7O2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-(5-aminotetrazol-2-yl)-N-[(Z)-(2-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(5-aminotetrazol-2-yl)-N-[(Z)-(2-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5424503 |
| Molecular Formula | C11H13N7O2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-(5-aminotetrazol-2-yl)-N-[(Z)-(2-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccccc1/C=N\NC(=O)Cn1nnc(N)n1 |
| InChI | InChI=1S/C11H13N7O2/c1-20-9-5-3-2-4-8(9)6-13-14-10(19)7-18-16-11(12)15-17-18/h2-6H,7H2,1H3,(H2,12,16)(H,14,19)/b13-6- |
| InChIKey | HDCAVQLJIASBOW-MLPAPPSSSA-N |
| XLogP | -0.59 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|