C14H19N7O3 — CID 6884488
2-(5-aminotetrazol-2-yl)-N-[(E)-(3-methoxy-4-propoxyphenyl)methylideneamino]acetamide (PubChem CID 6884488) has the molecular formula C14H19N7O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-(5-aminotetrazol-2-yl)-N-[(E)-(3-methoxy-4-propoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(5-aminotetrazol-2-yl)-N-[(E)-(3-methoxy-4-propoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6884488 |
| Molecular Formula | C14H19N7O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-(5-aminotetrazol-2-yl)-N-[(E)-(3-methoxy-4-propoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCOc1ccc(/C=N/NC(=O)Cn2nnc(N)n2)cc1OC |
| InChI | InChI=1S/C14H19N7O3/c1-3-6-24-11-5-4-10(7-12(11)23-2)8-16-17-13(22)9-21-19-14(15)18-20-21/h4-5,7-8H,3,6,9H2,1-2H3,(H2,15,19)(H,17,22)/b16-8+ |
| InChIKey | QNLLTYGMOZZLAB-LZYBPNLTSA-N |
| XLogP | 0.20 |
| TPSA | 129.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|