C19H16FN7O3 — CID 5190942
N-[[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide (PubChem CID 5190942) has the molecular formula C19H16FN7O3 and a molecular weight of 409.38 g/mol. Its IUPAC name is N-[[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-[[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 5190942 |
| Molecular Formula | C19H16FN7O3 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide |
| SMILES | COc1cc(C=NNC(=O)Cn2nnc(-c3ccc(F)cc3)n2)ccc1OCC#N |
| InChI | InChI=1S/C19H16FN7O3/c1-29-17-10-13(2-7-16(17)30-9-8-21)11-22-23-18(28)12-27-25-19(24-26-27)14-3-5-15(20)6-4-14/h2-7,10-11H,9,12H2,1H3,(H,23,28) |
| InChIKey | RCOSSQFTZCGKNY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|