C16H12F2N6O — CID 6902043
N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 6902043) has the molecular formula C16H12F2N6O and a molecular weight of 342.31 g/mol. Its IUPAC name is N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 6902043 |
| Molecular Formula | C16H12F2N6O |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)N/N=C/c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H12F2N6O/c17-13-7-6-11(8-14(13)18)9-19-20-15(25)10-24-22-16(21-23-24)12-4-2-1-3-5-12/h1-9H,10H2,(H,20,25)/b19-9+ |
| InChIKey | HQRGIPUXZFYMSP-DJKKODMXSA-N |
| XLogP | 1.77 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|