C19H20N6O — CID 8524097
2-(5-phenyltetrazol-2-yl)-N-[(Z)-(2,4,5-trimethylphenyl)methylideneamino]acetamide (PubChem CID 8524097) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-(5-phenyltetrazol-2-yl)-N-[(Z)-(2,4,5-trimethylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(5-phenyltetrazol-2-yl)-N-[(Z)-(2,4,5-trimethylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 8524097 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-(5-phenyltetrazol-2-yl)-N-[(Z)-(2,4,5-trimethylphenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(C)c(/C=N\NC(=O)Cn2nnc(-c3ccccc3)n2)cc1C |
| InChI | InChI=1S/C19H20N6O/c1-13-9-15(3)17(10-14(13)2)11-20-21-18(26)12-25-23-19(22-24-25)16-7-5-4-6-8-16/h4-11H,12H2,1-3H3,(H,21,26)/b20-11- |
| InChIKey | YCXNQPRIGBUZKB-JAIQZWGSSA-N |
| XLogP | 2.42 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|