C20H19F3N6O — CID 9408803
2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]-N-[(Z)-(2,4,5-trimethylphenyl)methylideneamino]acetamide (PubChem CID 9408803) has the molecular formula C20H19F3N6O and a molecular weight of 416.41 g/mol. Its IUPAC name is 2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]-N-[(Z)-(2,4,5-trimethylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]-N-[(Z)-(2,4,5-trimethylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 9408803 |
| Molecular Formula | C20H19F3N6O |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]-N-[(Z)-(2,4,5-trimethylphenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(C)c(/C=N\NC(=O)Cn2nnc(-c3cccc(C(F)(F)F)c3)n2)cc1C |
| InChI | InChI=1S/C20H19F3N6O/c1-12-7-14(3)16(8-13(12)2)10-24-25-18(30)11-29-27-19(26-28-29)15-5-4-6-17(9-15)20(21,22)23/h4-10H,11H2,1-3H3,(H,25,30)/b24-10- |
| InChIKey | IZWBFIQDOJQPEZ-VROXFSQNSA-N |
| XLogP | 3.43 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|