C17H13ClF3N5O — CID 2365775
N-(3-chloro-2-methylphenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide (PubChem CID 2365775) has the molecular formula C17H13ClF3N5O and a molecular weight of 395.77 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 2365775 |
| Molecular Formula | C17H13ClF3N5O |
| Molecular Weight | 395.77 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)Cn1nnc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H13ClF3N5O/c1-10-13(18)6-3-7-14(10)22-15(27)9-26-24-16(23-25-26)11-4-2-5-12(8-11)17(19,20)21/h2-8H,9H2,1H3,(H,22,27) |
| InChIKey | KNOIYZXSOGXABI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.77 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |