C15H10ClF3N6O — CID 7844984
N-(2-chloro-3-pyridinyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide (PubChem CID 7844984) has the molecular formula C15H10ClF3N6O and a molecular weight of 382.73 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 7844984 |
| Molecular Formula | C15H10ClF3N6O |
| Molecular Weight | 382.73 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(-c2cccc(C(F)(F)F)c2)n1)Nc1cccnc1Cl |
| InChI | InChI=1S/C15H10ClF3N6O/c16-13-11(5-2-6-20-13)21-12(26)8-25-23-14(22-24-25)9-3-1-4-10(7-9)15(17,18)19/h1-7H,8H2,(H,21,26) |
| InChIKey | ZIOYAFVYCXTOCX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.73 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|