C16H12F3N7O — CID 9408817
N-[(Z)-pyridin-4-ylmethylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide (PubChem CID 9408817) has the molecular formula C16H12F3N7O and a molecular weight of 375.31 g/mol. Its IUPAC name is N-[(Z)-pyridin-4-ylmethylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-[(Z)-pyridin-4-ylmethylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9408817 |
| Molecular Formula | C16H12F3N7O |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[(Z)-pyridin-4-ylmethylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(-c2cccc(C(F)(F)F)c2)n1)N/N=C\c1ccncc1 |
| InChI | InChI=1S/C16H12F3N7O/c17-16(18,19)13-3-1-2-12(8-13)15-23-25-26(24-15)10-14(27)22-21-9-11-4-6-20-7-5-11/h1-9H,10H2,(H,22,27)/b21-9- |
| InChIKey | STUKJWIXXAEIBB-NKVSQWTQSA-N |
| XLogP | 1.90 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|