C17H17F3N6O — CID 9408810
N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide (PubChem CID 9408810) has the molecular formula C17H17F3N6O and a molecular weight of 378.36 g/mol. Its IUPAC name is N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9408810 |
| Molecular Formula | C17H17F3N6O |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(-c2cccc(C(F)(F)F)c2)n1)N/N=C\[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C17H17F3N6O/c18-17(19,20)14-8-4-7-13(9-14)16-23-25-26(24-16)11-15(27)22-21-10-12-5-2-1-3-6-12/h1-2,4,7-10,12H,3,5-6,11H2,(H,22,27)/b21-10-/t12-/m1/s1 |
| InChIKey | XFZDXBINNKUJFC-RRSAXVHRSA-N |
| XLogP | 2.82 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|