C19H17F3N6O — CID 9408832
N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide (PubChem CID 9408832) has the molecular formula C19H17F3N6O and a molecular weight of 402.38 g/mol. Its IUPAC name is N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9408832 |
| Molecular Formula | C19H17F3N6O |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
| SMILES | Cc1ccc(/C=N\NC(=O)Cn2nnc(-c3cccc(C(F)(F)F)c3)n2)c(C)c1 |
| InChI | InChI=1S/C19H17F3N6O/c1-12-6-7-15(13(2)8-12)10-23-24-17(29)11-28-26-18(25-27-28)14-4-3-5-16(9-14)19(20,21)22/h3-10H,11H2,1-2H3,(H,24,29)/b23-10- |
| InChIKey | DNANWWKCNWCLJJ-RMORIDSASA-N |
| XLogP | 3.13 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|