C16H13BrN6O — CID 5235899
N-[(3-bromophenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 5235899) has the molecular formula C16H13BrN6O and a molecular weight of 385.23 g/mol. Its IUPAC name is N-[(3-bromophenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(3-bromophenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 5235899 |
| Molecular Formula | C16H13BrN6O |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | N-[(3-bromophenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)NN=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C16H13BrN6O/c17-14-8-4-5-12(9-14)10-18-19-15(24)11-23-21-16(20-22-23)13-6-2-1-3-7-13/h1-10H,11H2,(H,19,24) |
| InChIKey | XQTVRJYPHLENNJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|