C14H11FN6OS — CID 119055721
N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 119055721) has the molecular formula C14H11FN6OS and a molecular weight of 330.35 g/mol. Its IUPAC name is N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 119055721 |
| Molecular Formula | C14H11FN6OS |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)N/N=C/c1ccc(F)s1 |
| InChI | InChI=1S/C14H11FN6OS/c15-12-7-6-11(23-12)8-16-17-13(22)9-21-19-14(18-20-21)10-4-2-1-3-5-10/h1-8H,9H2,(H,17,22)/b16-8+ |
| InChIKey | SIEVEKZDJJESSF-LZYBPNLTSA-N |
| XLogP | 1.69 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|