C20H22FN7O — CID 4064611
N-[[4-(diethylamino)phenyl]methylideneamino]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide (PubChem CID 4064611) has the molecular formula C20H22FN7O and a molecular weight of 395.44 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methylideneamino]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 4064611 |
| Molecular Formula | C20H22FN7O |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)Cn2nnc(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C20H22FN7O/c1-3-27(4-2)18-11-5-15(6-12-18)13-22-23-19(29)14-28-25-20(24-26-28)16-7-9-17(21)10-8-16/h5-13H,3-4,14H2,1-2H3,(H,23,29) |
| InChIKey | SOQILEULZIDNJH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|