C18H29N5O — CID 170856208
N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 170856208) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 170856208 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)CN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C18H29N5O/c1-4-23(5-2)17-8-6-16(7-9-17)14-19-20-18(24)15-22-12-10-21(3)11-13-22/h6-9,14H,4-5,10-13,15H2,1-3H3,(H,20,24)/b19-14+ |
| InChIKey | YPYXRQMNFCUOMX-XMHGGMMESA-N |
| XLogP | 1.23 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|