C16H27ClN4O — CID 54599008
[2-[(2E)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride (PubChem CID 54599008) has the molecular formula C16H27ClN4O and a molecular weight of 326.87 g/mol. Its IUPAC name is [2-[(2E)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride.
| Compound Name | [2-[(2E)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 54599008 |
| Molecular Formula | C16H27ClN4O |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [2-[(2E)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)C[N+](C)(C)C)cc1.[Cl-] |
| InChI | InChI=1S/C16H26N4O.ClH/c1-6-19(7-2)15-10-8-14(9-11-15)12-17-18-16(21)13-20(3,4)5;/h8-12H,6-7,13H2,1-5H3;1H/b17-12+; |
| InChIKey | SYFFBENZYBSBBH-KCUXUEJTSA-N |
| XLogP | -1.31 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|