C18H22N4OS — CID 5400523
N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-pyridin-2-ylsulfanylacetamide (PubChem CID 5400523) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-pyridin-2-ylsulfanylacetamide.
| Compound Name | N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-pyridin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 5400523 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-pyridin-2-ylsulfanylacetamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)CSc2ccccn2)cc1 |
| InChI | InChI=1S/C18H22N4OS/c1-3-22(4-2)16-10-8-15(9-11-16)13-20-21-17(23)14-24-18-7-5-6-12-19-18/h5-13H,3-4,14H2,1-2H3,(H,21,23)/b20-13- |
| InChIKey | XYTSTFMMWIQRML-MOSHPQCFSA-N |
| XLogP | 3.17 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|