C26H27N3OS — CID 3898418
N-[[4-(diethylamino)phenyl]methylideneamino]-2-(9H-fluoren-9-ylsulfanyl)acetamide (PubChem CID 3898418) has the molecular formula C26H27N3OS and a molecular weight of 429.59 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methylideneamino]-2-(9H-fluoren-9-ylsulfanyl)acetamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2-(9H-fluoren-9-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 3898418 |
| Molecular Formula | C26H27N3OS |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2-(9H-fluoren-9-ylsulfanyl)acetamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)CSC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C26H27N3OS/c1-3-29(4-2)20-15-13-19(14-16-20)17-27-28-25(30)18-31-26-23-11-7-5-9-21(23)22-10-6-8-12-24(22)26/h5-17,26H,3-4,18H2,1-2H3,(H,28,30) |
| InChIKey | MHCDOQKNOACMSM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|