C20H25N3O — CID 824175
N-[[4-(diethylamino)phenyl]methylideneamino]-3-phenylpropanamide (PubChem CID 824175) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methylideneamino]-3-phenylpropanamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methylideneamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 824175 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methylideneamino]-3-phenylpropanamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N3O/c1-3-23(4-2)19-13-10-18(11-14-19)16-21-22-20(24)15-12-17-8-6-5-7-9-17/h5-11,13-14,16H,3-4,12,15H2,1-2H3,(H,22,24) |
| InChIKey | HVYJDKHLWLZZMR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|