C24H25N3O — CID 110515251
N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-2-phenylacetamide (PubChem CID 110515251) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-2-phenylacetamide.
| Compound Name | N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 110515251 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-2-phenylacetamide |
| SMILES | CCN(Cc1ccccc1)c1ccc(/C=N\NC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25N3O/c1-2-27(19-22-11-7-4-8-12-22)23-15-13-21(14-16-23)18-25-26-24(28)17-20-9-5-3-6-10-20/h3-16,18H,2,17,19H2,1H3,(H,26,28)/b25-18- |
| InChIKey | JWBNIYAYZHBCHO-BWAHOGKJSA-N |
| XLogP | 4.41 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|