C25H27N3O3 — CID 7966329
N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-3,5-dimethoxybenzamide (PubChem CID 7966329) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-3,5-dimethoxybenzamide.
| Compound Name | N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 7966329 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-3,5-dimethoxybenzamide |
| SMILES | CCN(Cc1ccccc1)c1ccc(/C=N\NC(=O)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C25H27N3O3/c1-4-28(18-20-8-6-5-7-9-20)22-12-10-19(11-13-22)17-26-27-25(29)21-14-23(30-2)16-24(15-21)31-3/h5-17H,4,18H2,1-3H3,(H,27,29)/b26-17- |
| InChIKey | SXWNNOQNOKRJSJ-ONUIUJJFSA-N |
| XLogP | 4.49 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|