C26H26N4O — CID 110526717
N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-1-methylindole-2-carboxamide (PubChem CID 110526717) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-1-methylindole-2-carboxamide.
| Compound Name | N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110526717 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-1-methylindole-2-carboxamide |
| SMILES | CCN(Cc1ccccc1)c1ccc(/C=N/NC(=O)c2cc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C26H26N4O/c1-3-30(19-21-9-5-4-6-10-21)23-15-13-20(14-16-23)18-27-28-26(31)25-17-22-11-7-8-12-24(22)29(25)2/h4-18H,3,19H2,1-2H3,(H,28,31)/b27-18+ |
| InChIKey | CDKFGXKZGRDNCF-OVVQPSECSA-N |
| XLogP | 4.97 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|