C29H35N3O4 — CID 4281813
N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-3,4,5-triethoxybenzamide (PubChem CID 4281813) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 4281813 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NN=Cc2ccc(N(CC)Cc3ccccc3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C29H35N3O4/c1-5-32(21-23-12-10-9-11-13-23)25-16-14-22(15-17-25)20-30-31-29(33)24-18-26(34-6-2)28(36-8-4)27(19-24)35-7-3/h9-20H,5-8,21H2,1-4H3,(H,31,33) |
| InChIKey | OGPDDHDEKYVJIN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|