C18H21N3O2 — CID 2361352
methyl N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]carbamate (PubChem CID 2361352) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is methyl N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]carbamate.
| Compound Name | methyl N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 2361352 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | methyl N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]carbamate |
| SMILES | CCN(Cc1ccccc1)c1ccc(C=NNC(=O)OC)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-3-21(14-16-7-5-4-6-8-16)17-11-9-15(10-12-17)13-19-20-18(22)23-2/h4-13H,3,14H2,1-2H3,(H,20,22) |
| InChIKey | YLBZBBQYXZHBQQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|