C21H18N2OS2 — CID 4267324
2-(9H-fluoren-9-ylsulfanyl)-N-[(3-methylthiophen-2-yl)methylideneamino]acetamide (PubChem CID 4267324) has the molecular formula C21H18N2OS2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylsulfanyl)-N-[(3-methylthiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(9H-fluoren-9-ylsulfanyl)-N-[(3-methylthiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4267324 |
| Molecular Formula | C21H18N2OS2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-(9H-fluoren-9-ylsulfanyl)-N-[(3-methylthiophen-2-yl)methylideneamino]acetamide |
| SMILES | Cc1ccsc1C=NNC(=O)CSC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H18N2OS2/c1-14-10-11-25-19(14)12-22-23-20(24)13-26-21-17-8-4-2-6-15(17)16-7-3-5-9-18(16)21/h2-12,21H,13H2,1H3,(H,23,24) |
| InChIKey | DBBWHLRMZMKRJU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|