C29H27N3OS — CID 3633291
N-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-2-(9H-fluoren-9-ylsulfanyl)acetamide (PubChem CID 3633291) has the molecular formula C29H27N3OS and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-2-(9H-fluoren-9-ylsulfanyl)acetamide.
| Compound Name | N-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-2-(9H-fluoren-9-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 3633291 |
| Molecular Formula | C29H27N3OS |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-2-(9H-fluoren-9-ylsulfanyl)acetamide |
| SMILES | Cc1cccc(-n2c(C)cc(C=NNC(=O)CSC3c4ccccc4-c4ccccc43)c2C)c1 |
| InChI | InChI=1S/C29H27N3OS/c1-19-9-8-10-23(15-19)32-20(2)16-22(21(32)3)17-30-31-28(33)18-34-29-26-13-6-4-11-24(26)25-12-5-7-14-27(25)29/h4-17,29H,18H2,1-3H3,(H,31,33) |
| InChIKey | FLBITMDLLKGNCD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|