C27H27N3O — CID 94845496
N-[(Z)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-naphthalen-1-ylacetamide (PubChem CID 94845496) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[(Z)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(Z)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 94845496 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N-[(Z)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-naphthalen-1-ylacetamide |
| SMILES | Cc1cc(C)cc(-n2c(C)cc(/C=N\NC(=O)Cc3cccc4ccccc34)c2C)c1 |
| InChI | InChI=1S/C27H27N3O/c1-18-12-19(2)14-25(13-18)30-20(3)15-24(21(30)4)17-28-29-27(31)16-23-10-7-9-22-8-5-6-11-26(22)23/h5-15,17H,16H2,1-4H3,(H,29,31)/b28-17- |
| InChIKey | FABQTMOPRRWRGF-QRQIAZFYSA-N |
| XLogP | 5.56 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|