C23H24BrN3OS — CID 92850704
2-[(2-bromophenyl)methylsulfanyl]-N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide (PubChem CID 92850704) has the molecular formula C23H24BrN3OS and a molecular weight of 470.44 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methylsulfanyl]-N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[(2-bromophenyl)methylsulfanyl]-N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 92850704 |
| Molecular Formula | C23H24BrN3OS |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 2-[(2-bromophenyl)methylsulfanyl]-N-[(Z)-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cccc(-n2c(C)cc(/C=N\NC(=O)CSCc3ccccc3Br)c2C)c1 |
| InChI | InChI=1S/C23H24BrN3OS/c1-16-7-6-9-21(11-16)27-17(2)12-20(18(27)3)13-25-26-23(28)15-29-14-19-8-4-5-10-22(19)24/h4-13H,14-15H2,1-3H3,(H,26,28)/b25-13- |
| InChIKey | ZVZXBGMITJBTCC-MXAYSNPKSA-N |
| XLogP | 5.55 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|