C20H18BrClN4OS — CID 126192130
2-[(2-bromophenyl)methylsulfanyl]-N-[(Z)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide (PubChem CID 126192130) has the molecular formula C20H18BrClN4OS and a molecular weight of 477.82 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methylsulfanyl]-N-[(Z)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-[(2-bromophenyl)methylsulfanyl]-N-[(Z)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126192130 |
| Molecular Formula | C20H18BrClN4OS |
| Molecular Weight | 477.82 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 2-[(2-bromophenyl)methylsulfanyl]-N-[(Z)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide |
| SMILES | Cc1c(/C=N\NC(=O)CSCc2ccccc2Br)c(Cl)nn1-c1ccccc1 |
| InChI | InChI=1S/C20H18BrClN4OS/c1-14-17(20(22)25-26(14)16-8-3-2-4-9-16)11-23-24-19(27)13-28-12-15-7-5-6-10-18(15)21/h2-11H,12-13H2,1H3,(H,24,27)/b23-11- |
| InChIKey | RUUITCYSQDUUDV-KSEXSDGBSA-N |
| XLogP | 4.98 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.82 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|